ethyl 2-[(4-chlorophenyl)carbamoyl-hydroxy-amino]benzoate
Modify Date: 2025-09-18 09:03:33
![ethyl 2-[(4-chlorophenyl)carbamoyl-hydroxy-amino]benzoate Structure](https://image.chemsrc.com/caspic/088/38493-73-1.png)
ethyl 2-[(4-chlorophenyl)carbamoyl-hydroxy-amino]benzoate structure
|
Common Name | ethyl 2-[(4-chlorophenyl)carbamoyl-hydroxy-amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 38493-73-1 | Molecular Weight | 334.75400 | |
| Density | 1.419g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H15ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-[(4-chlorophenyl)carbamoyl-hydroxyamino]benzoate |
|---|
| Density | 1.419g/cm3 |
|---|---|
| Molecular Formula | C16H15ClN2O4 |
| Molecular Weight | 334.75400 |
| Exact Mass | 334.07200 |
| PSA | 78.87000 |
| LogP | 4.01740 |
| Index of Refraction | 1.669 |
| InChIKey | PJILNWGLEYGHSH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccccc1N(O)C(=O)Nc1ccc(Cl)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |