butyl 4-(methylcarbamoyloxy)benzoate structure
|
Common Name | butyl 4-(methylcarbamoyloxy)benzoate | ||
|---|---|---|---|---|
| CAS Number | 38491-25-7 | Molecular Weight | 251.27800 | |
| Density | 1.125g/cm3 | Boiling Point | 351.7ºC at 760 mmHg | |
| Molecular Formula | C13H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.5ºC | |
| Name | butyl 4-(methylcarbamoyloxy)benzoate |
|---|
| Density | 1.125g/cm3 |
|---|---|
| Boiling Point | 351.7ºC at 760 mmHg |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.27800 |
| Flash Point | 166.5ºC |
| Exact Mass | 251.11600 |
| PSA | 64.63000 |
| LogP | 2.75260 |
| Index of Refraction | 1.51 |
| InChIKey | QQDKABCPMWHSBH-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)c1ccc(OC(=O)NC)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |