Methanediol dinitrate structure
|
Common Name | Methanediol dinitrate | ||
|---|---|---|---|---|
| CAS Number | 38483-28-2 | Molecular Weight | 138.03600 | |
| Density | 1.656g/cm3 | Boiling Point | 192.8ºC at 760 mmHg | |
| Molecular Formula | CH2N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 111.5ºC | |
| Name | nitrooxymethyl nitrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.656g/cm3 |
|---|---|
| Boiling Point | 192.8ºC at 760 mmHg |
| Molecular Formula | CH2N2O6 |
| Molecular Weight | 138.03600 |
| Flash Point | 111.5ºC |
| Exact Mass | 137.99100 |
| PSA | 110.10000 |
| LogP | 0.40690 |
| Index of Refraction | 1.445 |
| InChIKey | MKQRTTJKPCAWRP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])OCO[N+](=O)[O-] |
|
~%
Methanediol din... CAS#:38483-28-2 |
| Literature: Travagli Gazzetta Chimica Italiana, 1938 , vol. 68, p. 720 |
|
~%
Methanediol din... CAS#:38483-28-2 |
| Literature: Gafurov,R.G. et al. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1977 , vol. 26, p. 345 - 348 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1977 , vol. 26, p. 383 - 386 |
|
~%
Methanediol din... CAS#:38483-28-2 |
| Literature: Travagli Gazzetta Chimica Italiana, 1938 , vol. 68, p. 720 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Methylene glycol dinitrate [Forbidden] |
| Methylendinitrat |
| Bis-nitryloxy-methan |
| Methanediol,dinitrate |
| bis-nitryloxy-methane |
| Methylenglykol-dinitrat |
| Methylene dinitrate |
| nitric acid methanediyl ester |
| bis-nitrooxy-methane |
| Methylene glycol dinitrate |
| Methandiol-dinitrat |