3-bromo-4-tert-butylbenzoic acid
Modify Date: 2025-10-08 20:49:37
3-bromo-4-tert-butylbenzoic acid structure
|
Common Name | 3-bromo-4-tert-butylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 38473-89-1 | Molecular Weight | 257.124 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 327.7±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H13BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.0±25.9 °C | |
| Name | 3-Bromo-4-(tert-butyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 327.7±35.0 °C at 760 mmHg |
| Molecular Formula | C11H13BrO2 |
| Molecular Weight | 257.124 |
| Flash Point | 152.0±25.9 °C |
| Exact Mass | 256.009888 |
| PSA | 37.30000 |
| LogP | 4.40 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | SHBYNNKZVBDWRW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(=O)O)cc1Br |
| HS Code | 2916399090 |
|---|
CAS#:103275-21-4
CAS#:88-60-8
CAS#:98-51-1
CAS#:14034-08-3
CAS#:103391-77-1| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-bromo-4-tert-butylbenzoic acid |
| 3-Bromo-4-(2-methyl-2-propanyl)benzoic acid |
| Benzoic acid, 3-bromo-4-(1,1-dimethylethyl)- |