2-Hydroxy-7-nitronaphthalene structure
|
Common Name | 2-Hydroxy-7-nitronaphthalene | ||
|---|---|---|---|---|
| CAS Number | 38397-08-9 | Molecular Weight | 189.16700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-Nitro-[2]naphthol |
|---|
| Molecular Formula | C10H7NO3 |
|---|---|
| Molecular Weight | 189.16700 |
| Exact Mass | 189.04300 |
| PSA | 66.05000 |
| LogP | 2.97680 |
| InChIKey | PEUWECFMAMZFKM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2ccc(O)cc2c1 |
|
~%
2-Hydroxy-7-nit... CAS#:38397-08-9 |
| Literature: Hodgson; Ward Journal of the Chemical Society, 1947 , p. 327,330, 331 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |