5-amino-1-(2-hydroxy-2-phenylethyl)-1H-pyrazole-4-carboxylic acid ethyl ester structure
|
Common Name | 5-amino-1-(2-hydroxy-2-phenylethyl)-1H-pyrazole-4-carboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 383911-62-4 | Molecular Weight | 275.30300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-amino-1-(2-hydroxy-2-phenylethyl)-1H-pyrazole-4-carboxylic acid ethyl ester |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H17N3O3 |
|---|---|
| Molecular Weight | 275.30300 |
| Exact Mass | 275.12700 |
| PSA | 90.37000 |
| LogP | 1.95680 |
| InChIKey | ZIOCGXXFMKIESF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnn(CC(O)c2ccccc2)c1N |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| ethyl ester of 5-amino-1-(2-hydroxy-2-phenylethyl)-1H-pyrazole-4-carboxylic acid |
| ethyl ester of 5-amino-1-(2-hydroxy-2-phenylethyl)-1H-pyrazole carboxylic acid |
| ethyl 5-amino-1-(2-hydroxy-2-phenylethyl)-1H-pyrazole-4-carboxylate |
| 5-amino-1-(2-hydroxy-2-phenylethyl)-1H-pyrazole carboxylic acid ethyl ester |