Rifamycin B ethylamide structure
|
Common Name | Rifamycin B ethylamide | ||
|---|---|---|---|---|
| CAS Number | 38327-40-1 | Molecular Weight | 782.87300 | |
| Density | 1.32g/cm3 | Boiling Point | 947.3ºC at 760mmHg | |
| Molecular Formula | C41H54N2O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 526.7ºC | |
| Name | Rifamycin B ethylamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 947.3ºC at 760mmHg |
| Molecular Formula | C41H54N2O13 |
| Molecular Weight | 782.87300 |
| Flash Point | 526.7ºC |
| Exact Mass | 782.36300 |
| PSA | 219.41000 |
| LogP | 5.09230 |
| Index of Refraction | 1.612 |
| InChIKey | UDCVVHBNXAUZCQ-VATGUWRCSA-N |
| SMILES | CCNC(=O)COc1cc2c(O)c3c(O)c(C)c4c(c13)C(=O)C(C)(OC=CC(OC)C(C)C(OC(C)=O)C(C)C(O)C(C)C(O)C(C)C=CC=C(C)C(=O)N2)O4 |
|
~%
Rifamycin B eth... CAS#:38327-40-1 |
| Literature: Sensi,P. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 596 - 602 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| LS-9234 |
| rifamycin-B ethylamide |
| Rifamycin-B-aethylamid |