ethyl 4-sulfanylidenechromene-2-carboxylate
Modify Date: 2025-09-13 19:53:11
ethyl 4-sulfanylidenechromene-2-carboxylate structure
|
Common Name | ethyl 4-sulfanylidenechromene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 38322-77-9 | Molecular Weight | 234.27100 | |
| Density | 1.32g/cm3 | Boiling Point | 328.4ºC at 760 mmHg | |
| Molecular Formula | C12H10O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.4ºC | |
| Name | ethyl 4-sulfanylidenechromene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 328.4ºC at 760 mmHg |
| Molecular Formula | C12H10O3S |
| Molecular Weight | 234.27100 |
| Flash Point | 152.4ºC |
| Exact Mass | 234.03500 |
| PSA | 71.53000 |
| LogP | 3.33900 |
| Index of Refraction | 1.626 |
| InChIKey | DXWBCHFGULQNLY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(=S)c2ccccc2o1 |
| HS Code | 2930909090 |
|---|
|
~%
ethyl 4-sulfany... CAS#:38322-77-9 |
| Literature: Baker et al. Journal of the Chemical Society, 1954 , p. 998,1001 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Thioxo-4H-chromen-2-carbonsaeure-aethylester |
| Ethyl 4-thioxo-4H-1-benzopyran-2-carboxylate |
| ethyl 4-thioxo-4h-chromene-2-carboxylate |
| 4-thioxo-4H-chromene-2-carboxylic acid ethyl ester |
| 4H-1-Benzopyran-2-carboxylic acid,4-thioxo-,ethyl ester |