5-phenyl-3-trimethylsilylpent-2-en-1-ol structure
|
Common Name | 5-phenyl-3-trimethylsilylpent-2-en-1-ol | ||
|---|---|---|---|---|
| CAS Number | 383194-72-7 | Molecular Weight | 234.40900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-phenyl-3-trimethylsilylpent-2-en-1-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H22OSi |
|---|---|
| Molecular Weight | 234.40900 |
| Exact Mass | 234.14400 |
| PSA | 20.23000 |
| LogP | 3.41530 |
| InChIKey | WTQQFKNBLXXBIJ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C(=CCO)CCc1ccccc1 |
|
~88%
5-phenyl-3-trim... CAS#:383194-72-7 |
| Literature: Taguchi, Haruhiko; Ghoroku, Kazushi; Tadaki, Makoto; Tsubouchi, Akira; Takeda, Takeshi Journal of Organic Chemistry, 2002 , vol. 67, # 24 p. 8450 - 8456 |
|
~%
5-phenyl-3-trim... CAS#:383194-72-7 |
| Literature: Taguchi, Haruhiko; Ghoroku, Kazushi; Tadaki, Makoto; Tsubouchi, Akira; Takeda, Takeshi Journal of Organic Chemistry, 2002 , vol. 67, # 24 p. 8450 - 8456 |
|
~%
5-phenyl-3-trim... CAS#:383194-72-7 |
| Literature: Taguchi, Haruhiko; Ghoroku, Kazushi; Tadaki, Makoto; Tsubouchi, Akira; Takeda, Takeshi Organic Letters, 2001 , vol. 3, # 23 p. 3811 - 3814 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Penten-1-ol,5-phenyl-3-(trimethylsilyl)-,(2Z) |
| (Z)-5-phenyl-3-(trimethylsilyl)pent-2-en-1-ol |
| (Z)-5-phenyl-3-(trimethylsilyl)-2-penten-1-ol |