(E)-2,3-dibromo-4,4-bis(4-ethylphenyl)but-2-enoic acid
Modify Date: 2025-09-25 19:59:47
(E)-2,3-dibromo-4,4-bis(4-ethylphenyl)but-2-enoic acid structure
|
Common Name | (E)-2,3-dibromo-4,4-bis(4-ethylphenyl)but-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 38273-00-6 | Molecular Weight | 452.18000 | |
| Density | 1.512g/cm3 | Boiling Point | 531.2ºC at 760mmHg | |
| Molecular Formula | C20H20Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.1ºC | |
| Name | (E)-2,3-dibromo-4,4-bis(4-ethylphenyl)but-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.512g/cm3 |
|---|---|
| Boiling Point | 531.2ºC at 760mmHg |
| Molecular Formula | C20H20Br2O2 |
| Molecular Weight | 452.18000 |
| Flash Point | 275.1ºC |
| Exact Mass | 449.98300 |
| PSA | 37.30000 |
| LogP | 6.02930 |
| Index of Refraction | 1.622 |
| InChIKey | VJHYTULURZUAAF-VHEBQXMUSA-N |
| SMILES | CCc1ccc(C(C(Br)=C(Br)C(=O)O)c2ccc(CC)cc2)cc1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,3-Dibromo-4,4-bis(4-ethylphenyl)-2-butenoic acid |
| Edikron |
| 2-Butenoic acid,2,3-dibromo-4,4-bis(4-ethylphenyl) |