1,1'-(1,2-Phenylenedicarbonyl)bispiperidine
Modify Date: 2025-08-22 18:48:17
1,1'-(1,2-Phenylenedicarbonyl)bispiperidine structure
|
Common Name | 1,1'-(1,2-Phenylenedicarbonyl)bispiperidine | ||
|---|---|---|---|---|
| CAS Number | 38256-33-6 | Molecular Weight | 300.39500 | |
| Density | 1.157g/cm3 | Boiling Point | 506.9ºC at 760 mmHg | |
| Molecular Formula | C18H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.6ºC | |
| Name | [2-(piperidine-1-carbonyl)phenyl]-piperidin-1-ylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.157g/cm3 |
|---|---|
| Boiling Point | 506.9ºC at 760 mmHg |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.39500 |
| Flash Point | 230.6ºC |
| Exact Mass | 300.18400 |
| PSA | 40.62000 |
| LogP | 2.81460 |
| Index of Refraction | 1.579 |
| InChIKey | RNCBBFHBUCKNNB-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1C(=O)N1CCCCC1)N1CCCCC1 |
| HS Code | 2933399090 |
|---|
|
~%
1,1'-(1,2-Pheny... CAS#:38256-33-6 |
| Literature: v. Braun; Kaiser Chemische Berichte, 1922 , vol. 55, p. 1305 |
|
~%
1,1'-(1,2-Pheny... CAS#:38256-33-6 |
| Literature: v. Braun; Kaiser Chemische Berichte, 1922 , vol. 55, p. 1305 |
|
~%
1,1'-(1,2-Pheny... CAS#:38256-33-6 |
| Literature: v. Braun; Kaiser Chemische Berichte, 1922 , vol. 55, p. 1305 |
|
~%
1,1'-(1,2-Pheny... CAS#:38256-33-6 |
| Literature: v. Braun; Kaiser Chemische Berichte, 1922 , vol. 55, p. 1305 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,1'-Phthaloyl-di-piperidin |
| Benzene,1,2-bis(1-piperidylcarbonyl) |
| HMS1534I12 |
| 1,1'-phthaloyl-di-piperidine |
| Piperidine,1,1'-(1,2-phenylenedicarbonyl)bis |
| Phthalsaeure-dipiperidid |
| 1,1'-phthaloyl-bis-piperidine |
| Phthaloyl-dipiperidid |