dimethyl 2,3-bis(diphenylphosphoryl)butanedioate
Modify Date: 2024-04-08 17:12:24
dimethyl 2,3-bis(diphenylphosphoryl)butanedioate structure
|
Common Name | dimethyl 2,3-bis(diphenylphosphoryl)butanedioate | ||
|---|---|---|---|---|
| CAS Number | 38243-43-5 | Molecular Weight | 546.48700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H28O6P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl 2,3-bis(diphenylphosphoryl)butanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C30H28O6P2 |
|---|---|
| Molecular Weight | 546.48700 |
| Exact Mass | 546.13600 |
| PSA | 106.36000 |
| LogP | 4.09780 |
| InChIKey | GMEGOIULRIXJBT-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(C(=O)OC)P(=O)(c1ccccc1)c1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
|
~%
dimethyl 2,3-bi... CAS#:38243-43-5 |
| Literature: Fluck,E.; Kazenwadel,W. Phosphorus and the Related Group V Elements, 1976 , vol. 6, p. 195 - 200 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Butanedioic acid,2,3-bis(diphenylphosphinyl)-,dimethyl ester |