Carbonothioic acid, anhydrosulfide with methylcarbamodithioic acid, O-1-naphthalenyl ester structure
|
Common Name | Carbonothioic acid, anhydrosulfide with methylcarbamodithioic acid, O-1-naphthalenyl ester | ||
|---|---|---|---|---|
| CAS Number | 38234-98-9 | Molecular Weight | 277.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Carbonothioic acid, anhydrosulfide with methylcarbamodithioic acid, O-1-naphthalenyl ester |
|---|
| Molecular Formula | C13H11NO2S2 |
|---|---|
| Molecular Weight | 277.4 |
| InChIKey | RRJDZAVFZLLKRK-UHFFFAOYSA-N |
| SMILES | CNC(=S)SC(=O)Oc1cccc2ccccc12 |