N-[(4-methylpiperazin-1-yl)methyl]pyridine-4-carboxamide structure
|
Common Name | N-[(4-methylpiperazin-1-yl)methyl]pyridine-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 38221-52-2 | Molecular Weight | 234.29800 | |
| Density | 1.128g/cm3 | Boiling Point | 446.1ºC at 760 mmHg | |
| Molecular Formula | C12H18N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.6ºC | |
| Name | N-[(4-methylpiperazin-1-yl)methyl]pyridine-4-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.128g/cm3 |
|---|---|
| Boiling Point | 446.1ºC at 760 mmHg |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.29800 |
| Flash Point | 223.6ºC |
| Exact Mass | 234.14800 |
| PSA | 48.47000 |
| LogP | 0.28300 |
| Index of Refraction | 1.551 |
| InChIKey | FULSTGXOHJXJSE-UHFFFAOYSA-N |
| SMILES | CN1CCN(CNC(=O)c2ccncc2)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(4-METHYL-(PIPERAZIN-1-YL)METHYL)ISONICOTINAMIDE |
| N-((4-Methyl-1-piperazinyl)-methyl)-isonicotinamid [German] |
| N-(4-Methyl-1-piperazinylmethyl)isonicotinamide |
| ISONICOTINAMIDE,N-(4-METHYL-1-PIPERAZINYLMETHYL) |