1-Piperazinecarbodithioic acid, 4-methyl-, succinimidomethyl ester
Modify Date: 2025-09-30 07:15:26
1-Piperazinecarbodithioic acid, 4-methyl-, succinimidomethyl ester structure
|
Common Name | 1-Piperazinecarbodithioic acid, 4-methyl-, succinimidomethyl ester | ||
|---|---|---|---|---|
| CAS Number | 38221-41-9 | Molecular Weight | 287.40200 | |
| Density | 1.365g/cm3 | Boiling Point | 464.8ºC at 760 mmHg | |
| Molecular Formula | C11H17N3O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.9ºC | |
| Name | (2,5-dioxopyrrolidin-1-yl)methyl 4-methylpiperazine-1-carbodithioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.365g/cm3 |
|---|---|
| Boiling Point | 464.8ºC at 760 mmHg |
| Molecular Formula | C11H17N3O2S2 |
| Molecular Weight | 287.40200 |
| Flash Point | 234.9ºC |
| Exact Mass | 287.07600 |
| PSA | 101.25000 |
| LogP | 0.17210 |
| Index of Refraction | 1.631 |
| InChIKey | MSXMUZFDWZOUGX-UHFFFAOYSA-N |
| SMILES | CN1CCN(C(=S)SCN2C(=O)CCC2=O)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Piperazinecarbodithioic acid,4-methyl-,succinimidomethyl ester |
| 4-Methyl-piperazinyl-1-carbodithionsaeure((succinoyl-amino)-methyl)-ester [German] |
| 4-Methyl-1-piperazinecarbodithioic acid succinimidomethyl ester |