N2-(4-METHOXYBENZYL)-1,3,5-TRIAZINE-2,4-DIAMINE
Modify Date: 2025-09-18 19:09:43
N2-(4-METHOXYBENZYL)-1,3,5-TRIAZINE-2,4-DIAMINE structure
|
Common Name | N2-(4-METHOXYBENZYL)-1,3,5-TRIAZINE-2,4-DIAMINE | ||
|---|---|---|---|---|
| CAS Number | 38164-19-1 | Molecular Weight | 231.25400 | |
| Density | 1.317g/cm3 | Boiling Point | 490.8ºC at 760 mmHg | |
| Molecular Formula | C11H13N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.6ºC | |
| Name | 2-N-[(4-methoxyphenyl)methyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.317g/cm3 |
|---|---|
| Boiling Point | 490.8ºC at 760 mmHg |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.25400 |
| Flash Point | 250.6ºC |
| Exact Mass | 231.11200 |
| PSA | 89.91000 |
| LogP | 0.42650 |
| Index of Refraction | 1.669 |
| InChIKey | MUYBVGXUPMNFIT-UHFFFAOYSA-N |
| SMILES | COc1ccc(CNc2ncnc(N)n2)cc1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| N2-(4-Methoxybenzyl)-1,3,5-triazine-2,4-diamine |
| N-(4-Methoxy-benzyl)-[1,3,5]triazine-2,4-diamine |