Phenol,4,4',4''-(1,3,5-triazine-2,4,6-triyltri-2,1-ethanediyl)tris[2,6-bis(1,1-dimethylethyl)- structure
|
Common Name | Phenol,4,4',4''-(1,3,5-triazine-2,4,6-triyltri-2,1-ethanediyl)tris[2,6-bis(1,1-dimethylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 38146-17-7 | Molecular Weight | 778.15900 | |
| Density | 1.044g/cm3 | Boiling Point | 781.7ºC at 760mmHg | |
| Molecular Formula | C51H75N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 426.5ºC | |
| Name | 4-[2-[4,6-bis[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]-1,3,5-triazin-2-yl]ethyl]-2,6-ditert-butylphenol |
|---|
| Density | 1.044g/cm3 |
|---|---|
| Boiling Point | 781.7ºC at 760mmHg |
| Molecular Formula | C51H75N3O3 |
| Molecular Weight | 778.15900 |
| Flash Point | 426.5ºC |
| Exact Mass | 777.58100 |
| PSA | 99.36000 |
| LogP | 12.12900 |
| Index of Refraction | 1.553 |
| InChIKey | VGEJJASMUCILJT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(CCc2nc(CCc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)nc(CCc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)n2)cc(C(C)(C)C)c1O |
|
~87%
Phenol,4,4',4''... CAS#:38146-17-7 |
| Literature: Kelarev, V. I.; Laawad Yakhya, F.; Karakhanov, R. A.; Lunin, A. F.; Malova, O. V. Chemistry of Heterocyclic Compounds (New York, NY, United States), 1986 , vol. 22, # 1 p. 89 - 94 Khimiya Geterotsiklicheskikh Soedinenii, 1986 , vol. 22, # 1 p. 107 - 113 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |