1,2-Benzenedicarboxylicacid, 1-(2-oxiranylmethyl) 2-(2-propen-1-yl) ester
Modify Date: 2025-08-23 13:03:48
1,2-Benzenedicarboxylicacid, 1-(2-oxiranylmethyl) 2-(2-propen-1-yl) ester structure
|
Common Name | 1,2-Benzenedicarboxylicacid, 1-(2-oxiranylmethyl) 2-(2-propen-1-yl) ester | ||
|---|---|---|---|---|
| CAS Number | 3814-58-2 | Molecular Weight | 262.25800 | |
| Density | 1.227g/cm3 | Boiling Point | 363.6ºC at 760mmHg | |
| Molecular Formula | C14H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160ºC | |
| Name | 2-O-(oxiran-2-ylmethyl) 1-O-prop-2-enyl benzene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.227g/cm3 |
|---|---|
| Boiling Point | 363.6ºC at 760mmHg |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.25800 |
| Flash Point | 160ºC |
| Exact Mass | 262.08400 |
| PSA | 65.13000 |
| LogP | 1.58500 |
| Index of Refraction | 1.545 |
| InChIKey | OFILZJAFGRGHDE-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)c1ccccc1C(=O)OCC1CO1 |
| HS Code | 2918990090 |
|---|
|
~%
1,2-Benzenedica... CAS#:3814-58-2 |
| Literature: Shell Devel. Co. Patent: US2476922 , 1946 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 223-304-7 |
| Allyl 2,3-epoxypropyl phthalate |
| phthalic acid allyl ester-oxiranylmethyl ester |
| HMS3091F13 |
| Phthalsaeure-allylester-oxiranylmethylester |
| allyl oxiran-2-ylmethyl phthalate |