Chloridophosphoric acid bis[4-(1,1-dimethylethyl)phenyl] ester structure
|
Common Name | Chloridophosphoric acid bis[4-(1,1-dimethylethyl)phenyl] ester | ||
|---|---|---|---|---|
| CAS Number | 38135-31-8 | Molecular Weight | 380.84500 | |
| Density | 1.139g/cm3 | Boiling Point | 449.6ºC at 760 mmHg | |
| Molecular Formula | C20H26ClO3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 367.6ºC | |
| Name | 1-tert-butyl-4-[(4-tert-butylphenoxy)-chlorophosphoryl]oxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.139g/cm3 |
|---|---|
| Boiling Point | 449.6ºC at 760 mmHg |
| Molecular Formula | C20H26ClO3P |
| Molecular Weight | 380.84500 |
| Flash Point | 367.6ºC |
| Exact Mass | 380.13100 |
| PSA | 45.34000 |
| LogP | 7.08630 |
| Index of Refraction | 1.528 |
| InChIKey | PFWJBHJSKGMFNK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(OP(=O)(Cl)Oc2ccc(C(C)(C)C)cc2)cc1 |
| HS Code | 2931900090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Phosphorochloridic acid,bis(4-(1,1-dimethylethyl)phenyl) ester |
| Bis-(4-tert.-butyl-phenyl)-chlorophosphat |
| Di-4-tert-butylphenyl phosphorochloridate |
| chlorophosphoric acid bis-(4-tert-butyl-phenyl ester) |
| Di-p-tert-Butylphenylphosphorochloridate |
| Phosphorsaeure-bis-(4-tert.-butyl-phenylester)-chlorid |
| Chlorophosphorsaeure-bis-(4-tert-butyl-phenylester) |