2-benzylidene-1-methylindol-3-one structure
|
Common Name | 2-benzylidene-1-methylindol-3-one | ||
|---|---|---|---|---|
| CAS Number | 38072-57-0 | Molecular Weight | 235.28100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-benzylidene-1-methylindol-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H13NO |
|---|---|
| Molecular Weight | 235.28100 |
| Exact Mass | 235.10000 |
| PSA | 20.31000 |
| LogP | 3.42520 |
| InChIKey | MAHCZNMNPZKEMT-PTNGSMBKSA-N |
| SMILES | CN1C(=Cc2ccccc2)C(=O)c2ccccc21 |
|
~77%
2-benzylidene-1... CAS#:38072-57-0 |
| Literature: Daisley, Roy W.; Elagbar, Zaha A.; Walker, John Journal of Heterocyclic Chemistry, 1982 , vol. 19, p. 1013 - 1016 |
|
~%
2-benzylidene-1... CAS#:38072-57-0 |
| Literature: Tomchin; Marysheva Russian Journal of Organic Chemistry, 1996 , vol. 32, # 8 p. 1181 - 1185 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3H-Indol-3-one,1,2-dihydro-1-methyl-2-(phenylmethylene)-,(E) |
| 2-Phenyl-methyliden-1-methylindolin-3-on |
| (Z)-N-Methyl-2-(phenylmethylen)-indolin-3-on |
| 3H-Indol-3-one,1,2-dihydro-1-methyl-2-(phenylmethylene)-,(Z) |
| (Z)-2-benzylidene-1-methylindolin-3-one |