propan-2-yl 4-[(2-chloroacetyl)amino]benzoate
Modify Date: 2025-08-25 16:11:57
![propan-2-yl 4-[(2-chloroacetyl)amino]benzoate Structure](https://image.chemsrc.com/caspic/052/38064-88-9.png)
propan-2-yl 4-[(2-chloroacetyl)amino]benzoate structure
|
Common Name | propan-2-yl 4-[(2-chloroacetyl)amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 38064-88-9 | Molecular Weight | 255.69700 | |
| Density | 1.246g/cm3 | Boiling Point | 423.1ºC at 760 mmHg | |
| Molecular Formula | C12H14ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.7ºC | |
| Name | propan-2-yl 4-[(2-chloroacetyl)amino]benzoate |
|---|
| Density | 1.246g/cm3 |
|---|---|
| Boiling Point | 423.1ºC at 760 mmHg |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.69700 |
| Flash Point | 209.7ºC |
| Exact Mass | 255.06600 |
| PSA | 55.40000 |
| LogP | 2.50210 |
| Index of Refraction | 1.56 |
| InChIKey | ACETYTFNTSLETR-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)c1ccc(NC(=O)CCl)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |