4,5,6,7-tetrafluoro-2-methylisoindole structure
|
Common Name | 4,5,6,7-tetrafluoro-2-methylisoindole | ||
|---|---|---|---|---|
| CAS Number | 38053-09-7 | Molecular Weight | 203.13600 | |
| Density | 1.431g/cm3 | Boiling Point | 249.15ºC at 760 mmHg | |
| Molecular Formula | C9H5F4N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 104.483ºC | |
| Name | 4,5,6,7-tetrafluoro-2-methylisoindole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.431g/cm3 |
|---|---|
| Boiling Point | 249.15ºC at 760 mmHg |
| Molecular Formula | C9H5F4N |
| Molecular Weight | 203.13600 |
| Flash Point | 104.483ºC |
| Exact Mass | 203.03600 |
| PSA | 4.93000 |
| LogP | 2.73470 |
| Index of Refraction | 1.506 |
| InChIKey | GZGZEBKOUQJSOT-UHFFFAOYSA-N |
| SMILES | Cn1cc2c(F)c(F)c(F)c(F)c2c1 |
|
~86%
4,5,6,7-tetrafl... CAS#:38053-09-7 |
| Literature: Gribble, Gordon W.; LeHoullier, Craig S.; Sibi, Mukund P.; Allen, Robert W. Journal of Organic Chemistry, 1985 , vol. 50, # 10 p. 1611 - 1616 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-methyl-4,5,6,7-tetrafluoroisoindole |
| 2H-Isoindole,4,5,6,7-tetrafluoro-2-methyl |
| N-methyl-4,5,6,7-tetrafluoroisoindole |