tri-p-tolylhydroxytin structure
|
Common Name | tri-p-tolylhydroxytin | ||
|---|---|---|---|---|
| CAS Number | 38049-84-2 | Molecular Weight | 409.10000 | |
| Density | N/A | Boiling Point | 462.2ºC at 760 mmHg | |
| Molecular Formula | C21H22OSn | Melting Point | 108-109ºC | |
| MSDS | N/A | Flash Point | 233.3ºC | |
| Name | tri-p-tolylhydroxytin |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 462.2ºC at 760 mmHg |
|---|---|
| Melting Point | 108-109ºC |
| Molecular Formula | C21H22OSn |
| Molecular Weight | 409.10000 |
| Flash Point | 233.3ºC |
| Exact Mass | 410.06900 |
| PSA | 20.23000 |
| LogP | 2.57100 |
| InChIKey | UJUQRRNVJSPPGU-UHFFFAOYSA-N |
| SMILES | Cc1ccc([Sn](c2ccc(C)cc2)c2ccc(C)cc2)cc1.O |
| RIDADR | UN 2788 |
|---|---|
| HS Code | 2931900090 |
|
~%
tri-p-tolylhydr... CAS#:38049-84-2 |
| Literature: Lo, Kong-Mun; Das, V. G. Kumar; Yip, Wai-Hing; Mak, Thomas C. W. Journal of Organometallic Chemistry, 1991 , vol. 412, # 1.2 p. 21 - 29 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| (4-Me-C6H4)3Sn(OH) |
| TRIS(PARA-TOLYL)TINHYDROXIDE |
| tri-p-Tolyhydroxytin |
| Stannane,hydroxytris(4-methylphenyl) |