Phenyl(4-nitrophenyl) ketone oxime structure
|
Common Name | Phenyl(4-nitrophenyl) ketone oxime | ||
|---|---|---|---|---|
| CAS Number | 38032-13-2 | Molecular Weight | 242.23000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (Nz)-N-[(4-nitrophenyl)-phenylmethylidene]hydroxylamine |
|---|
| Molecular Formula | C13H10N2O3 |
|---|---|
| Molecular Weight | 242.23000 |
| Exact Mass | 242.06900 |
| PSA | 78.41000 |
| LogP | 3.34460 |
| InChIKey | LNOLJFCCYQZFBQ-YPKPFQOOSA-N |
| SMILES | O=[N+]([O-])c1ccc(C(=NO)c2ccccc2)cc1 |
| HS Code | 2928000090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |