2,2'-[9H-Xanthene-2,7-diylbis(oxy)]bis(N,N-dimethylethanamine) structure
|
Common Name | 2,2'-[9H-Xanthene-2,7-diylbis(oxy)]bis(N,N-dimethylethanamine) | ||
|---|---|---|---|---|
| CAS Number | 38013-78-4 | Molecular Weight | 356.45900 | |
| Density | 1.118g/cm3 | Boiling Point | 492ºC at 760 mmHg | |
| Molecular Formula | C21H28N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139ºC | |
| Name | 2-[[7-[2-(dimethylamino)ethoxy]-9H-xanthen-2-yl]oxy]-N,N-dimethylethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.118g/cm3 |
|---|---|
| Boiling Point | 492ºC at 760 mmHg |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.45900 |
| Flash Point | 139ºC |
| Exact Mass | 356.21000 |
| PSA | 34.17000 |
| LogP | 3.26390 |
| Index of Refraction | 1.566 |
| InChIKey | BSOCJVXJLPDOKB-UHFFFAOYSA-N |
| SMILES | CN(C)CCOc1ccc2c(c1)Cc1cc(OCCN(C)C)ccc1O2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,7-bis-(2-dimethylamino-ethoxy)-xanthene |
| 2,2'-(9H-Xanthene-2,7-diylbis(oxy))bis(N,N-dimethylethylamine) |
| Ethanamine,2,2'-[9H-xanthene-2,7-diylbis(oxy)]bis[N,N-dimethyl |
| ETHYLAMINE,2,2'-(9H-XANTHENE-2,7-DIYLBIS(OXY))BIS(N,N-DIMETHYL |
| 2-[[7-(2-dimethylaminoethyloxy)-9H-xanthen-2-yl]oxy]-N,N-dimethylethanamine |