2-[5-(carboxymethoxy)-2,2,3,3,4,4-hexafluoro-pentoxy]acetic acid structure
|
Common Name | 2-[5-(carboxymethoxy)-2,2,3,3,4,4-hexafluoro-pentoxy]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 3801-88-5 | Molecular Weight | 328.16300 | |
| Density | 1.548g/cm3 | Boiling Point | 469.9ºC at 760 mmHg | |
| Molecular Formula | C9H10F6O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238ºC | |
| Name | 2-[5-(carboxymethoxy)-2,2,3,3,4,4-hexafluoropentoxy]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.548g/cm3 |
|---|---|
| Boiling Point | 469.9ºC at 760 mmHg |
| Molecular Formula | C9H10F6O6 |
| Molecular Weight | 328.16300 |
| Flash Point | 238ºC |
| Exact Mass | 328.03800 |
| PSA | 93.06000 |
| LogP | 1.09470 |
| Index of Refraction | 1.398 |
| InChIKey | QWVLDQFGBRQUGO-UHFFFAOYSA-N |
| SMILES | O=C(O)COCC(F)(F)C(F)(F)C(F)(F)COCC(=O)O |
|
~%
2-[5-(carboxyme... CAS#:3801-88-5 |
| Literature: McBee et al. Journal of the American Chemical Society, 1958 , vol. 80, p. 1721 |
|
~%
2-[5-(carboxyme... CAS#:3801-88-5 |
| Literature: McBee et al. Journal of the American Chemical Society, 1958 , vol. 80, p. 1721 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,5-Bis-carboxymethoxy-2,2,3,3,4,4-hexafluor-pentan |
| 2-[5-(carboxymethyloxy)-2,2,3,3,4,4-hexafluoropentoxy]acetic acid |
| 2,2'-[(2,2,3,3,4,4-hexafluoropentane-1,5-diyl)bis(oxy)]diacetic acid |
| 5,5,6,6,7,7-hexafluoro-3,9-dioxa-undecanedioic acid |
| 5,5,6,6,7,7-Hexafluor-3,9-dioxa-undecandisaeure |