2,5-Dibromoisophthalic acid
Modify Date: 2025-08-30 21:46:58
2,5-Dibromoisophthalic acid structure
|
Common Name | 2,5-Dibromoisophthalic acid | ||
|---|---|---|---|---|
| CAS Number | 379711-35-0 | Molecular Weight | 323.923 | |
| Density | 2.2±0.1 g/cm3 | Boiling Point | 461.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C8H4Br2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.7±28.7 °C | |
| Name | 2,5-Dibromoisophthalic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 461.1±45.0 °C at 760 mmHg |
| Molecular Formula | C8H4Br2O4 |
| Molecular Weight | 323.923 |
| Flash Point | 232.7±28.7 °C |
| Exact Mass | 321.847626 |
| PSA | 74.60000 |
| LogP | 2.29 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.680 |
| InChIKey | MCBAPDGFMNMXOL-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(Br)cc(C(=O)O)c1Br |
|
~0%
2,5-Dibromoisop... CAS#:379711-35-0 |
| Literature: US2004/15010 A1, ; Page 3-4 ; |
|
~70%
2,5-Dibromoisop... CAS#:379711-35-0 |
| Literature: Journal of Organic Chemistry, , vol. 77, # 4 p. 2074 - 2079 |
| 2,5-Dibromo isonicotinic acid |
| 1,3-Benzenedicarboxylic acid, 2,5-dibromo- |
| 2,5-Dibromoisophthalic acid |