3-[[N-(3-Propoxy-2,4,6-triiodophenyl)-N-propylamino]carbonyl]propionic acid structure
|
Common Name | 3-[[N-(3-Propoxy-2,4,6-triiodophenyl)-N-propylamino]carbonyl]propionic acid | ||
|---|---|---|---|---|
| CAS Number | 37938-70-8 | Molecular Weight | 671.04800 | |
| Density | 2.065g/cm3 | Boiling Point | 646.7ºC at 760 mmHg | |
| Molecular Formula | C16H20I3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 344.9ºC | |
| Name | 4-oxo-4-(2,4,6-triiodo-3-propoxy-N-propylanilino)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.065g/cm3 |
|---|---|
| Boiling Point | 646.7ºC at 760 mmHg |
| Molecular Formula | C16H20I3NO4 |
| Molecular Weight | 671.04800 |
| Flash Point | 344.9ºC |
| Exact Mass | 670.85300 |
| PSA | 66.84000 |
| LogP | 4.89700 |
| Index of Refraction | 1.66 |
| InChIKey | ALBBSSRMMPGXEM-UHFFFAOYSA-N |
| SMILES | CCCOc1c(I)cc(I)c(N(CCC)C(=O)CCC(=O)O)c1I |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3'-Propoxy-N-propyl-2',4',6'-triiodosuccinanilic acid |
| Succinanilic acid,3'-propoxy-N-propyl-2',4',6'-triiodo |
| 4-oxo-4-[propyl(2,4,6-triiodo-3-propoxyphenyl)amino]butanoic acid |