1-[3-[[4-(dimethylamino)phenyl]diazenyl]phenyl]ethanone structure
|
Common Name | 1-[3-[[4-(dimethylamino)phenyl]diazenyl]phenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 3789-78-4 | Molecular Weight | 267.32600 | |
| Density | 1.07g/cm3 | Boiling Point | 437.7ºC at 760 mmHg | |
| Molecular Formula | C16H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.5ºC | |
| Name | 1-[3-[[4-(dimethylamino)phenyl]diazenyl]phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 437.7ºC at 760 mmHg |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.32600 |
| Flash Point | 218.5ºC |
| Exact Mass | 267.13700 |
| PSA | 45.03000 |
| LogP | 4.37060 |
| Index of Refraction | 1.571 |
| InChIKey | NXWXQKSMPANXPG-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cccc(N=Nc2ccc(N(C)C)cc2)c1 |
| HS Code | 2927000090 |
|---|
|
~%
1-[3-[[4-(dimet... CAS#:3789-78-4 |
| Literature: Sawicki; Gerber Journal of Organic Chemistry, 1956 , vol. 21, p. 410 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Ethanone,1-(3-((4-(dimethylamino)phenyl)azo)phenyl) |
| ACETOPHENONE,3'-((p-DIMETHYLAMINOPHENYL)AZO) |
| 1-[3-(4-Dimethylamino-phenylazo)-phenyl]-aethanon |
| 1-[3-(4-dimethylamino-phenylazo)-phenyl]-ethanone |
| 1-[3-[(4-dimethylaminophenyl)diazenyl]phenyl]ethanone |
| 3'-((p-Dimethylaminophenyl)azo)acetophenone |
| Ethanone,1-(3-((4-(dimethylamino)phenyl)azo)phenyl)-(9CI) |