2-[(2,2-dichloroacetyl)-[(4-methylsulfonylphenyl)methyl]amino]ethyl 2-bromoacetate structure
|
Common Name | 2-[(2,2-dichloroacetyl)-[(4-methylsulfonylphenyl)methyl]amino]ethyl 2-bromoacetate | ||
|---|---|---|---|---|
| CAS Number | 3785-28-2 | Molecular Weight | 461.15600 | |
| Density | 1.586g/cm3 | Boiling Point | 593.2ºC at 760 mmHg | |
| Molecular Formula | C14H16BrCl2NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 312.5ºC | |
| Name | 2-[(2,2-dichloroacetyl)-[(4-methylsulfonylphenyl)methyl]amino]ethyl 2-bromoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.586g/cm3 |
|---|---|
| Boiling Point | 593.2ºC at 760 mmHg |
| Molecular Formula | C14H16BrCl2NO5S |
| Molecular Weight | 461.15600 |
| Flash Point | 312.5ºC |
| Exact Mass | 458.93100 |
| PSA | 89.13000 |
| LogP | 3.24130 |
| Index of Refraction | 1.573 |
| InChIKey | NZOLBUNOTNPNKG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(CN(CCOC(=O)CBr)C(=O)C(Cl)Cl)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| b 6163 |
| m &ac1l2ehw |