2-[(2,4,6-trichlorophenyl)hydrazinylidene]propanedinitrile
Modify Date: 2025-11-24 19:15:32
![2-[(2,4,6-trichlorophenyl)hydrazinylidene]propanedinitrile Structure](https://image.chemsrc.com/caspic/357/3780-88-9.png)
2-[(2,4,6-trichlorophenyl)hydrazinylidene]propanedinitrile structure
|
Common Name | 2-[(2,4,6-trichlorophenyl)hydrazinylidene]propanedinitrile | ||
|---|---|---|---|---|
| CAS Number | 3780-88-9 | Molecular Weight | 273.50600 | |
| Density | 1.52g/cm3 | Boiling Point | 362.8ºC at 760 mmHg | |
| Molecular Formula | C9H3Cl3N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.2ºC | |
| Name | 2-[(2,4,6-trichlorophenyl)hydrazinylidene]propanedinitrile |
|---|
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 362.8ºC at 760 mmHg |
| Molecular Formula | C9H3Cl3N4 |
| Molecular Weight | 273.50600 |
| Flash Point | 173.2ºC |
| Exact Mass | 271.94200 |
| PSA | 71.97000 |
| LogP | 3.53486 |
| Index of Refraction | 1.644 |
| InChIKey | FACSZFSWIFLGOW-UHFFFAOYSA-N |
| SMILES | N#CC(C#N)=NNc1c(Cl)cc(Cl)cc1Cl |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |