N-(3-hydroxyphenyl)-4-nitro-benzamide structure
|
Common Name | N-(3-hydroxyphenyl)-4-nitro-benzamide | ||
|---|---|---|---|---|
| CAS Number | 37795-98-5 | Molecular Weight | 258.22900 | |
| Density | 1.446g/cm3 | Boiling Point | 393.7ºC at 760 mmHg | |
| Molecular Formula | C13H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.9ºC | |
| Name | N-(3-hydroxyphenyl)-4-nitrobenzamide |
|---|
| Density | 1.446g/cm3 |
|---|---|
| Boiling Point | 393.7ºC at 760 mmHg |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.22900 |
| Flash Point | 191.9ºC |
| Exact Mass | 258.06400 |
| PSA | 95.15000 |
| LogP | 3.14890 |
| Index of Refraction | 1.703 |
| InChIKey | VFQVJEPRLXMANV-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc(O)c1)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2924299090 |
|---|
|
~%
N-(3-hydroxyphe... CAS#:37795-98-5 |
| Literature: I.G.Farbenind. Patent: DE516156 , 1929 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 17, p. 485 |
|
~%
N-(3-hydroxyphe... CAS#:37795-98-5 |
| Literature: Ismailskii; Smirnow Zhurnal Obshchei Khimii, 1937 , vol. 7, p. 523,526 Bulletin de la Societe Chimique de France, 1937 , vol. <5>4, p. 94,99 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |