2-dipropan-2-yloxyphosphinothioylsulfanyl-N-methyl-acetamide structure
|
Common Name | 2-dipropan-2-yloxyphosphinothioylsulfanyl-N-methyl-acetamide | ||
|---|---|---|---|---|
| CAS Number | 37744-85-7 | Molecular Weight | 285.36400 | |
| Density | 1.176g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H20NO3PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-di(propan-2-yloxy)phosphinothioylsulfanyl-N-methylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.176g/cm3 |
|---|---|
| Molecular Formula | C9H20NO3PS2 |
| Molecular Weight | 285.36400 |
| Exact Mass | 285.06200 |
| PSA | 118.25000 |
| LogP | 4.03100 |
| Index of Refraction | 1.513 |
| InChIKey | WVJOTNPJRHZNFB-UHFFFAOYSA-N |
| SMILES | CNC(=O)CSP(=S)(OC(C)C)OC(C)C |
|
~%
2-dipropan-2-yl... CAS#:37744-85-7 |
| Literature: Hoegberg; Cassaday Journal of the American Chemical Society, 1951 , vol. 73, p. 557 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phosphorodithioic acid,O,O-bis(1-methylethyl) S-(2-(methylamino)-2-oxoethyl) ester |
| dithiophosphoric acid O,O'-diisopropyl ester-S-(methylcarbamoyl-methyl ester) |
| Dithiophosphorsaeure-O,O'-diisopropylester-S-(methylcarbamoyl-methylester) |
| Diisopropoxythiophosphorylmercapto-essigsaeure-methylamid |
| s-[2-(methylamino)-2-oxoethyl] o,o-dipropan-2-yl phosphorodithioate |
| O,O-Diisopropyl S-(N-methylcarbamoylmethyl) phosphorodithioate |