2-(diethylamino)ethyl 4-(butylamino)benzoate structure
|
Common Name | 2-(diethylamino)ethyl 4-(butylamino)benzoate | ||
|---|---|---|---|---|
| CAS Number | 3772-42-7 | Molecular Weight | 292.41600 | |
| Density | 1.022g/cm3 | Boiling Point | 416.7ºC at 760 mmHg | |
| Molecular Formula | C17H28N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.8ºC | |
| Name | 2-(diethylamino)ethyl 4-(butylamino)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.022g/cm3 |
|---|---|
| Boiling Point | 416.7ºC at 760 mmHg |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.41600 |
| Flash Point | 205.8ºC |
| Exact Mass | 292.21500 |
| PSA | 41.57000 |
| LogP | 3.47020 |
| Index of Refraction | 1.53 |
| InChIKey | JQMCLLAJJLVYOC-UHFFFAOYSA-N |
| SMILES | CCCCNc1ccc(C(=O)OCCN(CC)CC)cc1 |
| HS Code | 2922499990 |
|---|
|
~%
2-(diethylamino... CAS#:3772-42-7 |
| Literature: Strassmaier, Timothy; Kirk, Sarah R.; Banerji, Tapasree; Karpen, Jeffrey W. Bioorganic and Medicinal Chemistry Letters, 2008 , vol. 18, # 2 p. 645 - 649 |
|
~%
2-(diethylamino... CAS#:3772-42-7 |
| Literature: Skita; Stuehmer Patent: DE716668 , 1938 ; DRP/DRBP Org.Chem. |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2'-Dimethylaminoaethyl-4-butylamino-benzoat |
| 4-butylamino-benzoic acid-(2-diethylamino-ethyl ester) |
| BENZOIC ACID,p-BUTYLAMINO-,2-(DIETHYLAMINO)ETHYL ESTER |
| S 655 |
| 4-Butylamino-benzoesaeure-(2-diethylamino-ethylester) |
| 4-n-Butylamino-benzoesaeure-diaethylaminoaethyl ester [German] |
| T-Caine |
| 4-Butylamino-benzoesaeure-(2-diaethylamino-aethylester) |
| p-butylaminobenzoyldiethylaminoethyl hydrochloride |
| diethylaminoethyl p-butylaminobenzoate |
| Farmocaine |