MethADP
MethADP structure
|
Common Name | MethADP | ||
|---|---|---|---|---|
| CAS Number | 3768-14-7 | Molecular Weight | 425.22800 | |
| Density | 2.35g/cm3 | Boiling Point | 895.6ºC at 760mmHg | |
| Molecular Formula | C11H17N5O9P2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 495.4ºC | |
Use of MethADPMethADP is a specific CD73 inhibitor. |
| Name | adenosine 5'-methylenediphosphate |
|---|---|
| Synonym | More Synonyms |
| Description | MethADP is a specific CD73 inhibitor. |
|---|---|
| Related Catalog | |
| Target |
CD73[1]. |
| In Vitro | MethADP (AMP-CP: 20 μM) causes a marked inhibition of adenosine formation (0.96±0.96 μM) compared to untreated controls (9.6±1.5 μM) in A498 and RT4 cells, and MethADP (100 μM) completely inhibits the adenosine formation[1]. |
| References |
| Density | 2.35g/cm3 |
|---|---|
| Boiling Point | 895.6ºC at 760mmHg |
| Molecular Formula | C11H17N5O9P2 |
| Molecular Weight | 425.22800 |
| Flash Point | 495.4ºC |
| Exact Mass | 425.05000 |
| PSA | 242.99000 |
| Index of Refraction | 1.885 |
| InChIKey | OLCWZBFDIYXLAA-IOSLPCCCSA-N |
| SMILES | Nc1ncnc2c1ncn2C1OC(COP(=O)(O)CP(=O)(O)O)C(O)C1O |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:5135-30-8
CAS#:58337-46-5|
Identification of critical ligand binding determinants in Mycobacterium tuberculosis adenosine-5'-phosphosulfate reductase.
J. Med. Chem. 52 , 5485-95, (2009) Mycobacterium tuberculosis adenosine-5'-phosphosulfate (APS) reductase is an iron-sulfur protein and a validated target to develop new antitubercular agents, particularly for the treatment of latent i... |
|
|
Recruitment of beneficial M2 macrophages to injured spinal cord is orchestrated by remote brain choroid plexus.
Immunity 38(3) , 555-69, (2013) Monocyte-derived macrophages are essential for recovery after spinal cord injury, but their homing mechanism is poorly understood. Here, we show that although of common origin, the homing of proinflam... |
|
|
Crystal Structure of the Human Ecto-5′-Nucleotidase (CD73): Insights into the Regulation of Purinergic Signaling
Structure 20(12) , 2161-73, (2012) In vertebrates ecto-5′-nucleotidase (e5NT) catalyzes the hydrolysis of extracellular AMP to adenosine and represents the major control point for extracellular adenosine levels. Due to its pivotal role... |
| Dimethylepoxypropionamide |
| 3,3-Dimethyl-glycidsaeure-amid |
| Adenosine 5'-methylenediphosphate |
| 9-{5-O-[Hydroxy(phosphonomethyl)phosphoryl]pentofuranosyl}-9H-pur in-6-amine |
| 2-Aminocarbonyl-3-methyloxiran |
| 3,3-dimethyl-oxiranecarboxylic acid amide |
| 2,3-Epoxy-3-methylbutyramide |
| Oxiranecarboxamide,3,3-dimethyl |
| BUTYRAMIDE,2,3-EPOXY-3-METHYL |
| Dimethylepoxypropionamide [French] |