4(1H)-Quinazolinone,2,3-dihydro-3-(4-methylphenyl)-2-thioxo-
Modify Date: 2025-11-30 08:15:09
4(1H)-Quinazolinone,2,3-dihydro-3-(4-methylphenyl)-2-thioxo- structure
|
Common Name | 4(1H)-Quinazolinone,2,3-dihydro-3-(4-methylphenyl)-2-thioxo- | ||
|---|---|---|---|---|
| CAS Number | 37641-50-2 | Molecular Weight | 268.33400 | |
| Density | 1.36g/cm3 | Boiling Point | 442.9ºC at 760mmHg | |
| Molecular Formula | C15H12N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.6ºC | |
| Name | 3-(4-methylphenyl)-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 442.9ºC at 760mmHg |
| Molecular Formula | C15H12N2OS |
| Molecular Weight | 268.33400 |
| Flash Point | 221.6ºC |
| Exact Mass | 268.06700 |
| PSA | 73.69000 |
| LogP | 2.98280 |
| Index of Refraction | 1.726 |
| InChIKey | XDORDPWMJKSUFV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-n2c(=S)[nH]c3ccccc3c2=O)cc1 |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:2401-05-0
CAS#:66679-65-0| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(4-methylphenyl)-2-sulfanyl-3-hydroquinazolin-4-one |
| 2-thioxo-3-p-tolyl-2,3-dihydro-1H-quinazolin-4-one |
| 2-thioxo-3-p-tolyl-2,3-dihydroquinazolin-4(1H)-one |
| 2,3-dihydro-3-(4-methylphenyl)-2-thioxoquinazolin-4(1H)-one |
| 3-(p-toluyl)-2-thioxo-2,3-dihydroquinazolin-4(1H)-one |
| 3-(4-methylphenyl)-2-thioxo-1,2-dihydro-4(3H)-quinazolinone |
| 3-p-tolyl-2-thioxo-2,3-dihydroquinazolin-4(1H)-one |
| 3-(4-methylphenyl)-2-thioxo-2,3-dihydroquinazolin-4(1H)-one |
| 2-mercapto-3-p-tolyl-3h-quinazolin-4-one |