CHEMBRDG-BB 4140360 structure
|
Common Name | CHEMBRDG-BB 4140360 | ||
|---|---|---|---|---|
| CAS Number | 37640-73-6 | Molecular Weight | 220.22500 | |
| Density | 1.35g/cm3 | Boiling Point | 522.7ºC at 760 mmHg | |
| Molecular Formula | C11H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.9ºC | |
| Name | 3-(6-methoxy-1H-benzimidazol-2-yl)propanoic acid |
|---|
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 522.7ºC at 760 mmHg |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.22500 |
| Flash Point | 269.9ºC |
| Exact Mass | 220.08500 |
| PSA | 75.21000 |
| LogP | 1.58870 |
| Index of Refraction | 1.644 |
| InChIKey | BERQTZASCMALML-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc(CCC(=O)O)[nH]c2c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |