butyl 3,5-dihydroxybenzoate,hydrate
Modify Date: 2025-08-27 17:10:51
butyl 3,5-dihydroxybenzoate,hydrate structure
|
Common Name | butyl 3,5-dihydroxybenzoate,hydrate | ||
|---|---|---|---|---|
| CAS Number | 37622-59-6 | Molecular Weight | 438.46800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H30O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | butyl 3,5-dihydroxybenzoate,hydrate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H30O9 |
|---|---|
| Molecular Weight | 438.46800 |
| Exact Mass | 438.18900 |
| PSA | 142.75000 |
| LogP | 4.04510 |
| InChIKey | UIDWBEXUSVLIBV-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)c1cc(O)cc(O)c1.CCCCOC(=O)c1cc(O)cc(O)c1.O |
| HS Code | 2918290000 |
|---|
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 3,5-Dihydroxybenzoic acid butyl ester hemihydrate |
| butyl 3,5-dihydroxybenzoate hydrate |
| BENZOIC ACID,3,5-DIHYDROXY-,BUTYL ESTER,HEMIHYDRATE |