1-(3,4-dimethylphenoxy)-2,4-dinitro-benzene
Modify Date: 2024-10-22 10:32:23
1-(3,4-dimethylphenoxy)-2,4-dinitro-benzene structure
|
Common Name | 1-(3,4-dimethylphenoxy)-2,4-dinitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 3761-21-5 | Molecular Weight | 288.25500 | |
| Density | 1.332g/cm3 | Boiling Point | 390.9ºC at 760 mmHg | |
| Molecular Formula | C14H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.2ºC | |
| Name | 4-(2,4-dinitrophenoxy)-1,2-dimethylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.332g/cm3 |
|---|---|
| Boiling Point | 390.9ºC at 760 mmHg |
| Molecular Formula | C14H12N2O5 |
| Molecular Weight | 288.25500 |
| Flash Point | 161.2ºC |
| Exact Mass | 288.07500 |
| PSA | 100.87000 |
| LogP | 4.95850 |
| Index of Refraction | 1.614 |
| InChIKey | WXOISAJGDXAIEE-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1C |
| HS Code | 2909309090 |
|---|
|
~%
1-(3,4-dimethyl... CAS#:3761-21-5 |
| Literature: Reinheimer et al. Journal of Organic Chemistry, 1957 , vol. 22, p. 1743 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| (3,4-Dimethyl-phenyl)-(2,4-dinitro-phenyl)-aether |
| (3,4-dimethyl-phenyl)-(2,4-dinitro-phenyl)-ether |
| 1-(3,4-dimethylphenoxy)-2,4-dinitrobenzene |