5-(2-furylmethylidene)-3-phenyl-2-sulfanylidene-thiazolidin-4-one structure
|
Common Name | 5-(2-furylmethylidene)-3-phenyl-2-sulfanylidene-thiazolidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 37530-61-3 | Molecular Weight | 287.35700 | |
| Density | 1.47g/cm3 | Boiling Point | 421.8ºC at 760 mmHg | |
| Molecular Formula | C14H9NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.9ºC | |
| Name | (5E)-5-(furan-2-ylmethylidene)-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 421.8ºC at 760 mmHg |
| Molecular Formula | C14H9NO2S2 |
| Molecular Weight | 287.35700 |
| Flash Point | 208.9ºC |
| Exact Mass | 287.00700 |
| PSA | 90.84000 |
| LogP | 3.75040 |
| Index of Refraction | 1.745 |
| InChIKey | VXHVBXJIAJRGCB-FMIVXFBMSA-N |
| SMILES | O=C1C(=Cc2ccco2)SC(=S)N1c1ccccc1 |
|
~84%
5-(2-furylmethy... CAS#:37530-61-3 |
| Literature: Donia, Shaffy Galal Pakistan Journal of Scientific and Industrial Research, 1992 , vol. 35, # 12 p. 489 - 491 |
|
~%
5-(2-furylmethy... CAS#:37530-61-3 |
| Literature: Subenko; Turkewitsch Zhurnal Obshchei Khimii, 1957 , vol. 27, p. 3275,3277; engl. Ausg. S. 3311 |
| 5-Furfuryliden-3-phenyl-2-thioxo-thiazolidin-4-on |
| 5-Furan-2-ylmethylene-3-phenyl-2-thioxo-thiazolidin-4-one |
| HMS2557I23 |
| 5-furfurylidene-3-phenyl-2-thioxo-thiazolidin-4-one |