formaldehyde,2-methyloxirane,4-nonylphenol structure
|
Common Name | formaldehyde,2-methyloxirane,4-nonylphenol | ||
|---|---|---|---|---|
| CAS Number | 37523-33-4 | Molecular Weight | 308.45600 | |
| Density | N/A | Boiling Point | 330.6ºC at 760mmHg | |
| Molecular Formula | C19H32O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.2ºC | |
| Name | formaldehyde,2-methyloxirane,4-nonylphenol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 330.6ºC at 760mmHg |
|---|---|
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.45600 |
| Flash Point | 184.2ºC |
| Exact Mass | 308.23500 |
| PSA | 49.83000 |
| LogP | 5.54140 |
| InChIKey | XKHVSAPHPSWWCJ-UHFFFAOYSA-N |
| SMILES | C=O.CC1CO1.CCCCCCCCCc1ccc(O)cc1 |
| Formaldehyde,polymer with methyloxirane and 4-nonylphenol |
| Formaldehyde,polymer with 2-methyloxirane and 4-nonylphenol |
| 4-Nonylphenol,formaldehyde resin,propoxylated |
| P-Nonylphenol,polymer with propylene oxide and formaldehyde |
| Formaldehyde propylene oxide p-nonylphenol polymer |