1-[3,5-Bis(trifluoromethyl)phenyl]ethanamine Hydrochloride structure
|
Common Name | 1-[3,5-Bis(trifluoromethyl)phenyl]ethanamine Hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 374822-27-2 | Molecular Weight | 293.637 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10ClF6N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[3,5-bis(trifluoromethyl)phenyl]ethanamine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10ClF6N |
|---|---|
| Molecular Weight | 293.637 |
| Exact Mass | 293.040588 |
| PSA | 26.02000 |
| LogP | 5.24620 |
| InChIKey | DWSPCWWXKNPRFN-UHFFFAOYSA-N |
| SMILES | CC(N)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.Cl |
| HS Code | 2921499090 |
|---|
|
~98%
1-[3,5-Bis(trif... CAS#:374822-27-2 |
| Literature: Pineiro, Jose Luis Castro; Dinnell, Kevin; Elliott, Jason Matthew; Hollingworth, Gregory John; Shaw, Duncan Edward; Swain, Christopher John; Yang, Lihu Patent: US2003/225059 A1, 2003 ; Location in patent: Page 21 ; |
|
~%
1-[3,5-Bis(trif... CAS#:374822-27-2 |
| Literature: MERCK and CO., INC. Patent: WO2004/41279 A1, 2004 ; Location in patent: Page/Page column 155 ; WO 2004/041279 A1 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzenemethanamine, α-methyl-3,5-bis(trifluoromethyl)-, hydrochloride (1:1) |
| 1-[3,5-Bis(trifluoromethyl)phenyl]ethanamine HCl |
| 1-(3,5-Bis(trifluoromethyl)phenyl)ethanamine hydrochloride |
| 1-[3,5-Bis(trifluoromethyl)phenyl]ethanamine hydrochloride (1:1) |
| bis-(trifluoromethyl)phenylethylamine hydrochloride |
| (1R)-1-[3,5-Bis(trifluoromethyl)phenyl]ethylamine hydrochloride |