Benzo(f)quinazoline, 1,3-diamino-5,6-dihydro-8-methoxy- structure
|
Common Name | Benzo(f)quinazoline, 1,3-diamino-5,6-dihydro-8-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 37436-50-3 | Molecular Weight | 242.27600 | |
| Density | 1.337g/cm3 | Boiling Point | 570.5ºC at 760 mmHg | |
| Molecular Formula | C13H14N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.8ºC | |
| Name | 8-methoxy-5,6-dihydrobenzo[f]quinazoline-1,3-diamine |
|---|
| Density | 1.337g/cm3 |
|---|---|
| Boiling Point | 570.5ºC at 760 mmHg |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.27600 |
| Flash Point | 298.8ºC |
| Exact Mass | 242.11700 |
| PSA | 87.05000 |
| LogP | 2.57760 |
| Index of Refraction | 1.696 |
| InChIKey | PTYPACYJLPCXBJ-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)CCc1nc(N)nc(N)c1-2 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |