Acetamide,N-[3,5-difluoro-4-[2-(4-nitrophenyl)diazenyl]phenyl]- structure
|
Common Name | Acetamide,N-[3,5-difluoro-4-[2-(4-nitrophenyl)diazenyl]phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 3743-87-1 | Molecular Weight | 320.25100 | |
| Density | 1.43g/cm3 | Boiling Point | 542.7ºC at 760mmHg | |
| Molecular Formula | C14H10F2N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282ºC | |
| Name | N-[3,5-difluoro-4-[(4-nitrophenyl)diazenyl]phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 542.7ºC at 760mmHg |
| Molecular Formula | C14H10F2N4O3 |
| Molecular Weight | 320.25100 |
| Flash Point | 282ºC |
| Exact Mass | 320.07200 |
| PSA | 99.64000 |
| LogP | 4.84300 |
| Index of Refraction | 1.609 |
| InChIKey | ICGRNBQHIVMSMS-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc(F)c(N=Nc2ccc([N+](=O)[O-])cc2)c(F)c1 |
| HS Code | 2927000090 |
|---|
|
~%
Acetamide,N-[3,... CAS#:3743-87-1 |
| Literature: Ishikawa,N. et al. Journal of Organic Chemistry, 1965 , vol. 30, p. 3878 - 3882 |
|
~%
Acetamide,N-[3,... CAS#:3743-87-1 |
| Literature: Ishikawa,N. et al. Journal of Organic Chemistry, 1965 , vol. 30, p. 3878 - 3882 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2,6-Difluor-4'-nitro-4-acetamido-azobenzol |
| N-[3,5-DIFLUORO-4-(4-NITROPHENYL)DIAZENYL-PHENYL]ACETAMIDE |
| n-{3,5-difluoro-4-[(e)-(4-nitrophenyl)diazenyl]phenyl}acetamide |