2-(3-phenylprop-2-enoxycarbonylamino)acetic acid structure
|
Common Name | 2-(3-phenylprop-2-enoxycarbonylamino)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 3742-89-0 | Molecular Weight | 235.23600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-phenylprop-2-enoxycarbonylamino)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13NO4 |
|---|---|
| Molecular Weight | 235.23600 |
| Exact Mass | 235.08400 |
| PSA | 79.12000 |
| LogP | 1.71500 |
| InChIKey | QIWLPWHIQZWGDY-UHFFFAOYSA-N |
| SMILES | O=C(O)CNC(=O)OCC=Cc1ccccc1 |
| HS Code | 2924199090 |
|---|
|
~%
2-(3-phenylprop... CAS#:3742-89-0 |
| Literature: Ciba-Geigy Corporation Patent: US4962196 A1, 1990 ; |
|
~83%
2-(3-phenylprop... CAS#:3742-89-0 |
| Literature: Kinoshita, Hideki; Inomata, Katsuhiko; Kameda, Takuo; Kotake, Hiroshi Chemistry Letters, 1985 , p. 515 - 518 |
|
~%
2-(3-phenylprop... CAS#:3742-89-0 |
| Literature: Barltrop,J.A.; Schofield,P. Journal of the Chemical Society, 1965 , p. 4758 - 4765 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Glycine,N-[[(3-phenyl-2-propenyl)oxy]carbonyl] |
| N-(Cinnamyloxycarbonyl)-glycin |
| N-cinnamyloxycarbonylglycine |