8-chloro-3-methyl-1-phenyl-5H-2,3-benzodiazepin-4-one
Modify Date: 2024-09-24 11:05:49
8-chloro-3-methyl-1-phenyl-5H-2,3-benzodiazepin-4-one structure
|
Common Name | 8-chloro-3-methyl-1-phenyl-5H-2,3-benzodiazepin-4-one | ||
|---|---|---|---|---|
| CAS Number | 37388-25-3 | Molecular Weight | 284.74000 | |
| Density | 1.26g/cm3 | Boiling Point | 429.5ºC at 760mmHg | |
| Molecular Formula | C16H13ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.6ºC | |
| Name | 8-chloro-3-methyl-1-phenyl-5H-2,3-benzodiazepin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 429.5ºC at 760mmHg |
| Molecular Formula | C16H13ClN2O |
| Molecular Weight | 284.74000 |
| Flash Point | 213.6ºC |
| Exact Mass | 284.07200 |
| PSA | 32.67000 |
| LogP | 2.48040 |
| Index of Refraction | 1.635 |
| InChIKey | LLOVZVVFDZKHKI-UHFFFAOYSA-N |
| SMILES | CN1N=C(c2ccccc2)c2cc(Cl)ccc2CC1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-Chloro-3,5-dihydro-3-methyl-1-phenyl-2,3-(4H)-benzodiazepin-4-one |
| 2,3-(4H)-BENZODIAZEPIN-4-ONE,3,5-DIHYDRO-8-CHLORO-3-METHYL-1-PHENYL |
| Isodiazepam |
| 8-chloro-3-methyl-1-phenyl-3,5-dihydro-benzo[d][1,2]diazepin-4-one |
| 2,3-(4H)-Benzodiazepin-4-one,8-chloro-3,5-dihydro-3-methyl-1-phenyl |