3,3,4,4-Tetrachlorotetrahydrothiophene 1,1-dioxide
Modify Date: 2024-01-11 18:52:19
3,3,4,4-Tetrachlorotetrahydrothiophene 1,1-dioxide structure
|
Common Name | 3,3,4,4-Tetrachlorotetrahydrothiophene 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 3737-41-5 | Molecular Weight | 257.950 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 399.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C4H4Cl4O2S | Melting Point | 174ºC | |
| MSDS | N/A | Flash Point | 195.1±27.9 °C | |
| Name | 3,3,4,4-Tetrachlorosulfolane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 399.0±42.0 °C at 760 mmHg |
| Melting Point | 174ºC |
| Molecular Formula | C4H4Cl4O2S |
| Molecular Weight | 257.950 |
| Flash Point | 195.1±27.9 °C |
| Exact Mass | 255.868607 |
| PSA | 42.52000 |
| LogP | 0.77 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | GCAXGCSCRRVVLF-UHFFFAOYSA-N |
| SMILES | O=S1(=O)CC(Cl)(Cl)C(Cl)(Cl)C1 |
| RIDADR | UN 2811 6.1/PG III |
|---|---|
| RTECS | XN0870000 |
| Packaging Group | III |
| HS Code | 2934300000 |
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,3,4,4-Tetrachlorotetrahydrothiophene 1,1-dioxide |
| 2,5-DIHYDRO-3,3,4,4-TETRACHLOROTHIOPHENE-1,1-DIOXIDE |
| EINECS 223-113-9 |
| 3,3,4,4-Tetrachloro-tetrahydro-thiophene 1,1-dioxide |
| 3,3,4,4-tetrachlorothiolane 1,1-dioxide |
| Thiophene, 3,3,4,4-tetrachlorotetrahydro-, 1,1-dioxide |