(E)-2-(4-([1,1'-biphenyl]-4-yl)thiazol-2-yl)-3-((4-butoxyphenyl)amino)acrylonitrile
Modify Date: 2026-04-16 16:02:19
![(E)-2-(4-([1,1'-biphenyl]-4-yl)thiazol-2-yl)-3-((4-butoxyphenyl)amino)acrylonitrile Structure](https://www.chemsrc.com/extcaspic/448/373612-76-1.png)
(E)-2-(4-([1,1'-biphenyl]-4-yl)thiazol-2-yl)-3-((4-butoxyphenyl)amino)acrylonitrile structure
|
Common Name | (E)-2-(4-([1,1'-biphenyl]-4-yl)thiazol-2-yl)-3-((4-butoxyphenyl)amino)acrylonitrile | ||
|---|---|---|---|---|
| CAS Number | 373612-76-1 | Molecular Weight | 451.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H25N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (E)-2-(4-([1,1'-biphenyl]-4-yl)thiazol-2-yl)-3-((4-butoxyphenyl)amino)acrylonitrile |
|---|
| Molecular Formula | C28H25N3OS |
|---|---|
| Molecular Weight | 451.6 |
| InChIKey | AUHVXVLVGVIMFY-LYBHJNIJSA-N |
| SMILES | CCCCOC1=CC=C(C=C1)N/C=C(\C#N)/C2=NC(=CS2)C3=CC=C(C=C3)C4=CC=CC=C4 |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
Total 1, Current Page 1 of 1
1