[2-(diethylthiophosphor-S-yl)ethyl]diethylammonium hydrogen oxalate
Modify Date: 2025-08-27 14:25:03
![[2-(diethylthiophosphor-S-yl)ethyl]diethylammonium hydrogen oxalate Structure](https://image.chemsrc.com/caspic/175/3734-97-2.png)
[2-(diethylthiophosphor-S-yl)ethyl]diethylammonium hydrogen oxalate structure
|
Common Name | [2-(diethylthiophosphor-S-yl)ethyl]diethylammonium hydrogen oxalate | ||
|---|---|---|---|---|
| CAS Number | 3734-97-2 | Molecular Weight | 359.37600 | |
| Density | N/A | Boiling Point | 315.1ºC at 760 mmHg | |
| Molecular Formula | C12H26NO7PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.3ºC | |
| Name | amiton oxalate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 315.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H26NO7PS |
| Molecular Weight | 359.37600 |
| Flash Point | 144.3ºC |
| Exact Mass | 359.11700 |
| PSA | 148.48000 |
| LogP | 2.39810 |
| InChIKey | LUBCBEANYIETCW-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)SCCN(CC)CC.O=C(O)C(=O)O |
| RIDADR | UN 2783 |
|---|---|
| Packaging Group | I |
| Hazard Class | 6.1(a) |
| HS Code | 2922199090 |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| oxalic acid—S-[2-(diethylamino)ethyl] O,O-diethyl phosphorothioate |
| Tetram,acid oxalate |
| S-[2-(diethylamino)ethyl] O,O-diethyl phosphorothioate ethanedioate (1:1) |
| Chipman R-6,199 |
| Amiton oxalate |
| Tetram monooxalate |
| Tetram |
| Tetram 75 |
| Citram |
| S-2-diethylaminoethyl O,O-diethyl phosphorothioate oxalate (1:1) |
| Caswell No. 333E |
| Amiton hydrogen oxalate |
| 2-diethoxyphosphorylsulfanyl-N,N-diethylethanamine,oxalic acid |