Relugan D
Modify Date: 2025-08-29 12:45:22
Relugan D structure
|
Common Name | Relugan D | ||
|---|---|---|---|---|
| CAS Number | 37337-65-8 | Molecular Weight | 264.32400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Relugan D |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H20N4O2 |
|---|---|
| Molecular Weight | 264.32400 |
| Exact Mass | 264.15900 |
| PSA | 50.26000 |
| LogP | 0.57500 |
| InChIKey | NNMIKCDMTMJXQX-UHFFFAOYSA-N |
| SMILES | C1N2CN3CN1CN(C2)C3.C=O.Oc1ccccc1 |
| SP-8014 Resin |
| Formaldehyde,polymer with phenol and 1,3,5,7-tetraazatricyclo(3.3.1.1(sup 3,7))decane |
| Phenol,formaldehyde,hexamethylentetramine polymer |
| BT 3 |
| BT 4 |
| PB 207 (phenolic resin) |
| Phenol,formaldehyde,hexamethylenetetramine polymer |
| Rezibon B 555 |
| Plastaresin 222 |